For research use only. Not for therapeutic Use.
4-Fluorobenzaldehyde-2,3,5,6-d4(Cat No.:M006742)is a deuterated version of 4-fluorobenzaldehyde, where four hydrogen atoms are replaced by deuterium. This isotopically labeled compound is used in research, particularly in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to enhance the precision of molecular analysis. The deuterium substitution improves the accuracy of measurements, making it valuable for studying reaction mechanisms, chemical kinetics, and structural interactions. 4-Fluorobenzaldehyde-2,3,5,6-d4 is commonly employed in organic synthesis and pharmaceutical research, especially for tracking and studying aromatic compounds and their interactions in complex systems.
CAS Number | 93111-27-4 |
Synonyms | 2,3,5,6-tetradeuterio-4-fluorobenzaldehyde |
Molecular Formula | C7HD4FO |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetradeuterio-4-fluorobenzaldehyde |
InChI | InChI=1S/C7H5FO/c8-7-3-1-6(5-9)2-4-7/h1-5H/i1D,2D,3D,4D |
InChIKey | UOQXIWFBQSVDPP-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])F)[2H] |