For research use only. Not for therapeutic Use.
4-Fluorobenzene-1,3-dicarboxylic acid is an aromatic compound with a benzene ring substituted by a fluorine atom at the 4-position and carboxylic acid groups (-COOH) at the 1- and 3-positions. This molecular arrangement provides both acidity and electron-withdrawing properties from the fluorine, influencing the compound’s reactivity in organic synthesis. It serves as a useful intermediate in producing polymers, pharmaceuticals, and agrochemicals, where the fluorine atom and carboxyl groups enable modifications, making it valuable in materials and medicinal chemistry research.
CAS Number | 327-95-7 |
Molecular Formula | C8H5FO4 |
Purity | ≥95% |
IUPAC Name | 4-fluorobenzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C8H5FO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
InChIKey | OPWLKVOLSUNGEI-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)F |