For research use only. Not for therapeutic Use.
4-Fluorobenzo[c][1,2]oxaborol-1(3H)-ol (Cat.No:L004102) is a crucial compound in boron-based chemistry. Its unique structure, incorporating a fluorobenzoxaborole moiety, imparts specialized reactivity and properties. This compound serves as a valuable building block in the synthesis of specialized materials, particularly in the pharmaceutical industry.
CAS Number | 174671-88-6 |
Molecular Formula | C7H6BFO2 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-1-hydroxy-3H-2,1-benzoxaborole |
InChI | InChI=1S/C7H6BFO2/c9-7-3-1-2-6-5(7)4-11-8(6)10/h1-3,10H,4H2 |
InChIKey | WBKLSDSNRDYOJN-UHFFFAOYSA-N |
SMILES | B1(C2=C(CO1)C(=CC=C2)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |