For research use only. Not for therapeutic Use.
(4-Fluorobenzofuran-2-yl)boronic acid (Cat.No:L003593) is a crucial chemical compound in modern organic synthesis. Its boronic acid functionality grants it significant utility as a versatile building block in the formation of carbon-carbon bonds, particularly in Suzuki-Miyaura cross-coupling reactions. This compound finds extensive application in the development of pharmaceuticals and advanced materials.
CAS Number | 1423791-86-9 |
Molecular Formula | C8H6BFO3 |
Purity | ≥95% |
IUPAC Name | (4-fluoro-1-benzofuran-2-yl)boronic acid |
InChI | InChI=1S/C8H6BFO3/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-4,11-12H |
InChIKey | ANIKDESUQGWETI-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(O1)C=CC=C2F)(O)O |