For research use only. Not for therapeutic Use.
4-Fluorobenzyl Isothiocyanate（Cat No.:L007100）, is an organic compound widely used in chemical synthesis and as a reagent in various chemical reactions. It contains a fluorobenzyl group (-C6H4F) linked to an isothiocyanate functional group (-N=C=S), allowing it to participate in diverse transformations, including nucleophilic substitution reactions. This compound is employed in the preparation of complex organic molecules, particularly in the synthesis of pharmaceuticals and agrochemicals.
| Catalog Number | L007100 |
| CAS Number | 2740-88-7 |
| Molecular Formula | C8H6FNS |
| Purity | ≥95% |
| IUPAC Name | 1-fluoro-4-(isothiocyanatomethyl)benzene |
| InChI | InChI=1S/C8H6FNS/c9-8-3-1-7(2-4-8)5-10-6-11/h1-4H,5H2 |
| InChIKey | LPVNPJMEWWUFHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C=S)F |
