For research use only. Not for therapeutic Use.
4-Fluorothioanisole-d4 is a deuterated compound crucial for advanced chemical and pharmaceutical research. Featuring four deuterium atoms, it provides enhanced stability and precision in analytical techniques such as mass spectrometry and NMR spectroscopy. This isotopically labeled analog is essential for studying the metabolic pathways and reaction mechanisms of fluorinated aromatic compounds. It ensures accurate quantification and reliable results, making it an ideal standard for high-precision research in drug development, synthetic chemistry, and the investigation of sulfur-containing compounds.
| Catalog Number | R006877 |
| CAS Number | 1189510-57-3 |
| Synonyms | 1-Fluoro-4-(methylthio)-benzene-d4; 4-Fluoro-1-methylsulfanylbenzene-d4; 4-Fluorophenyl Methyl Sulfide-d4; |
| Molecular Formula | C7H7FS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,2,4,5-tetradeuterio-3-fluoro-6-methylsulfanylbenzene |
| InChI | InChI=1S/C7H7FS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3/i2D,3D,4D,5D |
| InChIKey | XFUMHENRNCUHOH-QFFDRWTDSA-N |
| SMILES | CSC1=CC=C(C=C1)F |
