For research use only. Not for therapeutic Use.
4-Formyl-2-methoxybenzoic Acid(CACT: L016359) is a high-purity aromatic compound characterized by a formyl and methoxy functional group on a benzoic acid backbone. This versatile molecule is widely used as an intermediate in pharmaceutical research and fine chemical synthesis. Its unique structure makes it suitable for the development of bioactive molecules, materials science applications, and as a precursor in complex organic synthesis. With excellent stability and precise formulation, 4-Formyl-2-methoxybenzoic Acid ensures consistent and reproducible performance, making it a reliable choice for researchers advancing innovation in drug discovery and advanced chemical studies.
Catalog Number | L016359 |
CAS Number | 194928-58-0 |
Molecular Formula | C9H8O4 |
Purity | ≥95% |
IUPAC Name | 4-formyl-2-methoxybenzoic acid |
InChI | InChI=1S/C9H8O4/c1-13-8-4-6(5-10)2-3-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
InChIKey | QAYQOARPTBPKMR-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C=O)C(=O)O |