For research use only. Not for therapeutic Use.
(4-Formyl-3-methoxyphenyl)boronic acid(Cat No.:L007395), is a significant chemical compound with the molecular formula C8H9BO4. It comprises a phenyl ring substituted with a formyl group at position 4 and a methoxy group at position 3, both attached to a boronic acid functional group. This compound is widely utilized in organic synthesis and medicinal chemistry as a valuable reagent, especially in the formation of carbon-carbon bonds and as a key component in the development of various pharmaceuticals and agrochemicals. Its versatility makes it a crucial building block in the field of organic chemistry.
CAS Number | 815620-00-9 |
Molecular Formula | C8H9BO4 |
Purity | ≥95% |
IUPAC Name | (4-formyl-3-methoxyphenyl)boronic acid |
InChI | InChI=1S/C8H9BO4/c1-13-8-4-7(9(11)12)3-2-6(8)5-10/h2-5,11-12H,1H3 |
InChIKey | LZVMUJGTTXMMTE-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)C=O)OC)(O)O |