For research use only. Not for therapeutic Use.
4-Formylbenzoic Acid(Cat No.:R051124)is an aromatic carboxylic acid featuring both aldehyde and carboxyl functional groups, making it a versatile compound in organic synthesis and pharmaceutical research. It serves as a key intermediate in the preparation of various chemical products, including polymers, dyes, and pharmaceuticals. Its reactivity is particularly useful in forming Schiff bases and other derivatives, which are widely employed in medicinal chemistry. Due to its dual functionality, 4-Formylbenzoic Acid plays an essential role in the development of novel compounds and materials for advanced research applications.
CAS Number | 619-66-9 |
Synonyms | Terephthalaldehydic Acid; 4-Carboxybenzaldehyde; 4-Carboxylbenzaldehyde; NSC 15797; Terephthalaldehyde Acid; Terephthaldehydic Acid; p-Benzoic Acid Aldehyde; p-Carboxybenzaldehyde; p-Formylbenzoic Acid; |
Molecular Formula | C8H6O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-formylbenzoic acid |
InChI | InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11) |
InChIKey | GOUHYARYYWKXHS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |