For research use only, not for therapeutic use.
4-Formylfuran-2-carboxylic acid(Cat No.:L007673), is a chemical compound comprising a furan ring substituted with a formyl group at the 4-position and a carboxylic acid group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a key intermediate in the creation of diverse organic molecules, particularly in the development of pharmaceuticals and fine chemicals.
Catalog Number | L007673 |
CAS Number | 1784641-78-6 |
Molecular Formula | C6H4O4 |
Purity | ≥95% |
IUPAC Name | 4-formylfuran-2-carboxylic acid |
InChI | InChI=1S/C6H4O4/c7-2-4-1-5(6(8)9)10-3-4/h1-3H,(H,8,9) |
InChIKey | VGJYVADXDZIDMK-UHFFFAOYSA-N |
SMILES | C1=C(OC=C1C=O)C(=O)O |