For research use only. Not for therapeutic Use.
4-(Furan-2-yl)aniline(Cat No.:L046529)is an organic compound with a distinctive structure that combines a furan ring linked to an aniline moiety. This arrangement enhances its electron-donating capabilities, making it a valuable intermediate in the synthesis of dyes, pharmaceuticals, and advanced polymers. Its presence in molecular frameworks contributes to the development of materials with unique optical and electronic properties. Additionally, 4-(furan-2-yl)aniline serves as a precursor in the creation of various heterocyclic compounds, offering potential applications in medicinal chemistry, particularly in the design of drug molecules with improved pharmacokinetic profiles.
CAS Number | 59147-02-3 |
Molecular Formula | C10H9NO |
Purity | ≥95% |
IUPAC Name | 4-(furan-2-yl)aniline |
InChI | InChI=1S/C10H9NO/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2 |
InChIKey | QSKZDXHSTLCYPB-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C2=CC=C(C=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |