For research use only. Not for therapeutic Use.
4-Hydroperoxy Cyclophosphamide-d4(Cat No.:S000181)is a deuterated derivative of cyclophosphamide, a widely used chemotherapeutic agent. This isotopically labeled compound, featuring four deuterium atoms, is primarily used in pharmacokinetic and metabolic studies to trace and understand the drug’s behavior in biological systems. The hydroperoxy group plays a crucial role in its activation mechanism, making it an important intermediate in the bioactivation pathway of cyclophosphamide. With high isotopic purity, 4-Hydroperoxy Cyclophosphamide-d4 is essential for advanced research in oncology and drug metabolism studies.
CAS Number | 1246816-71-6 |
Molecular Formula | C7H11D4Cl2N2O4P |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | N,N-bis(2-chloro-2,2-dideuterioethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
InChI | InChI=1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(13)10-7(15-12)1-6-14-16/h7,12H,1-6H2,(H,10,13)/i2D2,3D2 |
InChIKey | VPAWVRUHMJVRHU-RRVWJQJTSA-N |
SMILES | [2H]C([2H])(CN(CC([2H])([2H])Cl)P1(=O)NC(CCO1)OO)Cl |