For research use only. Not for therapeutic Use.
4-Hydroxy-1-oxo-1,2-dihydroisoquinoline-3-carboxamide(Cat No.:L007700), is a chemical compound featuring an isoquinoline core with a hydroxyl group at the 4-position, a carbonyl group at the 1-position, and an amide group at the 3-position. This specific molecular structure is significant in medicinal chemistry and organic synthesis. Researchers utilize it as a key intermediate in creating various organic molecules, especially in developing pharmaceuticals and fine chemicals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in chemical research and chemical development.
CAS Number | 99275-67-9 |
Molecular Formula | C10H8N2O3 |
Purity | ≥95% |
IUPAC Name | 4-hydroxy-1-oxo-2H-isoquinoline-3-carboxamide |
InChI | InChI=1S/C10H8N2O3/c11-9(14)7-8(13)5-3-1-2-4-6(5)10(15)12-7/h1-4,13H,(H2,11,14)(H,12,15) |
InChIKey | IBXVQOAFBNLVDH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C(NC2=O)C(=O)N)O |