Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-hydroxy-1H,2H-pyrrolo[1,2-d][1,2,4]triazin-1-one
For research use only. Not for therapeutic Use.
4-hydroxy-1H,2H-pyrrolo[1,2-d][1,2,4]triazin-1-one(Cat No.:L007604), is a chemical compound with a unique pyrrolo[1,2-d][1,2,4]triazin-1-one core and a hydroxy group at the 4-position. This compound is significant in medicinal chemistry and organic synthesis. Researchers utilize its specialized structure as a building block for the creation of novel molecules. Its distinct heterocyclic ring system offers opportunities for chemical modifications, enabling the design and synthesis of diverse compounds. Scientists leverage its properties in the development of potential pharmaceutical agents, contributing to advancements in drug discovery efforts and the synthesis of new organic materials for various applications.
CAS Number | 50269-88-0 |
Molecular Formula | C6H5N3O2 |
Purity | ≥95% |
IUPAC Name | 2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione |
InChI | InChI=1S/C6H5N3O2/c10-5-4-2-1-3-9(4)6(11)8-7-5/h1-3H,(H,7,10)(H,8,11) |
InChIKey | VWKCMLFUVPXMBI-UHFFFAOYSA-N |
SMILES | C1=CN2C(=C1)C(=O)NNC2=O |