Home
>
Chemical Reagents>Aldehydes> 4-Hydroxy-2'-methoxy-5'-(trifluoromethyl)-[1,1'-biphenyl]-3-carbaldehyde
For research use only. Not for therapeutic Use.
4-Hydroxy-2′-methoxy-5′-(trifluoromethyl)-[1,1′-biphenyl]-3-carbaldehyde(Cat No.:L019868)is a complex aromatic compound used in advanced organic synthesis and pharmaceutical research. Featuring a biphenyl structure with functional groups including a hydroxyl, methoxy, trifluoromethyl, and aldehyde, this molecule is valuable for creating bioactive compounds and drug intermediates. Its multifaceted functional groups allow for diverse chemical modifications, making it an essential building block in the synthesis of potential therapeutic agents. With high reactivity and purity, this compound is crucial for innovative research in medicinal chemistry.
CAS Number | 1261953-85-8 |
Molecular Formula | C15H11F3O3 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-5-[2-methoxy-5-(trifluoromethyl)phenyl]benzaldehyde |
InChI | InChI=1S/C15H11F3O3/c1-21-14-5-3-11(15(16,17)18)7-12(14)9-2-4-13(20)10(6-9)8-19/h2-8,20H,1H3 |
InChIKey | YSDXGQCHJWTQJQ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C2=CC(=C(C=C2)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |