For research use only. Not for therapeutic Use.
4-Hydroxy-2-methylbenzaldehyde(Cat No.:M144179), is a chemical compound with the molecular formula C8H8O2. It features a hydroxy group (-OH) and a methyl group (-CH3) attached to a benzaldehyde ring. This compound’s unique structure makes it potentially valuable in various chemical applications, including organic synthesis, and as a building block for the creation of complex molecules. The combination of a hydroxy group and a methyl group on the benzene ring can influence its reactivity and properties, making it useful for designing and crafting novel compounds with specific functionalities.
CAS Number | 41438-18-0 |
Synonyms | 4-Hydroxy-2-methylbenzaldehyde; 41438-18-0; 4-Hydroxy-2-methyl-benzaldehyde; 2-methyl-4-hydroxybenzaldehyde; Benzaldehyde, 4-hydroxy-2-methyl-; JDWWIEFMFPWBST-UHFFFAOYSA-N |
Molecular Formula | C8H8O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-hydroxy-2-methylbenzaldehyde |
InChI | InChI=1S/C8H8O2/c1-6-4-8(10)3-2-7(6)5-9/h2-5,10H,1H3 |
InChIKey | JDWWIEFMFPWBST-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)O)C=O |