For research use only. Not for therapeutic Use.
4-Hydroxy-3-methoxybenzaldehyde-d3, a deuterated form of vanillin, features three deuterium atoms for enhanced stability and precise analytical studies. This compound is crucial in pharmaceutical research for investigating metabolic pathways and drug interactions, using advanced techniques like NMR and mass spectrometry. In organic chemistry, it aids in understanding reaction mechanisms and the synthesis of complex molecules. Additionally, in food science and flavor chemistry, 4-Hydroxy-3-methoxybenzaldehyde-d3 is used to trace the origins and transformations of flavor compounds, supporting the development of high-quality food products and flavorings.
CAS Number | 74495-74-2 |
Synonyms | Vanillin-d3 |
Molecular Formula | C8H8O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 4-hydroxy-3-(trideuteriomethoxy)benzaldehyde |
InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3/i1D3 |
InChIKey | MWOOGOJBHIARFG-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C=O)O |