For research use only. Not for therapeutic Use.
4-Hydroxy-3-methoxycinnamaldehyde (Cat No.:R072505) is a naturally occurring phenolic compound found in various plants, particularly in cinnamon. Known for its antioxidant, anti-inflammatory, and antimicrobial properties, it plays a significant role in traditional medicine and modern pharmacological research. This compound has been studied for its potential benefits in managing oxidative stress, inflammation, and microbial infections. Its ability to inhibit pro-inflammatory pathways and scavenge free radicals makes it a valuable candidate for developing therapies for chronic diseases and skin care products.
| CAS Number | 458-36-6 |
| Synonyms | Coniferaldehyde; Coniferyl aldehyde |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enal |
| InChI | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
| InChIKey | DKZBBWMURDFHNE-NSCUHMNNSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
