For research use only. Not for therapeutic Use.
4-Hydroxy-3-methoxymandelic acid(Cat No.:R007590)is a phenolic compound commonly used in biochemical and medical research. It is a metabolite of catecholamines such as adrenaline and noradrenaline, making it particularly important in studies related to the nervous system and metabolic disorders. This compound, featuring a hydroxy group at the 4-position and a methoxy group at the 3-position on the mandelic acid structure, is crucial for diagnosing and monitoring conditions like pheochromocytoma and neuroblastoma. Its role in neurotransmitter metabolism makes 4-Hydroxy-3-methoxymandelic acid an essential tool in clinical and pharmacological research.
CAS Number | 55-10-7 |
Synonyms | α,4-Dihydroxy-3-methoxybenzeneacetic Acid; (+/-)-Vanilmandelic Acid; (4-Hydroxy-3-methoxyphenyl)glycolic Acid; 3-Methoxy-4-hydroxyphenylhydroxyacetic Acid; HMMA; VMA; Vanilinmandelic Acid; dl-Vanillomandelic Acid; |
Molecular Formula | C9H10O5 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetic acid |
InChI | InChI=1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
InChIKey | CGQCWMIAEPEHNQ-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C(C(=O)O)O)O |