For research use only. Not for therapeutic Use.
4’-Hydroxy-3’-methylacetophenone(Cat No.:R028003)is an organic compound often used as an intermediate in the synthesis of pharmaceuticals, fragrances, and other specialty chemicals. Featuring both a hydroxyl and a methyl group on its aromatic ring, it exhibits unique reactivity, making it valuable in chemical manufacturing and organic synthesis. It is particularly noted for its role in synthesizing compounds with antioxidant or anti-inflammatory properties, and it has potential applications in medicinal chemistry. Additionally, due to its aromatic characteristics, it may contribute to flavor and fragrance formulations, enhancing sensory attributes in consumer products.
CAS Number | 876-02-8 |
Synonyms | 1-(3-Methyl-4-hydroxyphenyl)ethanone; 1-(4-Hydroxy-3-methylphenyl)ethanone; 2- Methyl-4-acetylphenol; 3’-Methyl-4’-hydroxyacetophenone; 4-Acetyl-2-methylphenol; 4-Hydroxyl-3-methyl acetophenone; 4’-Hydroxy-3’- methylacetophenone; NSC 63365 |
Molecular Formula | C9H10O2 |
Purity | ≥95% |
Target | Bacterial |
Storage | RT |
IUPAC Name | 1-(4-hydroxy-3-methylphenyl)ethanone |
InChI | InChI=1S/C9H10O2/c1-6-5-8(7(2)10)3-4-9(6)11/h3-5,11H,1-2H3 |
InChIKey | LXBHHIZIQVZGFN-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)C(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |