For research use only. Not for therapeutic Use.
4-Hydroxy-3-nitrobenzonitrile is an aromatic compound featuring a hydroxyl group and a nitro group positioned on a benzonitrile ring. This compound is valuable in organic synthesis and pharmaceutical chemistry, serving as an intermediate for developing bioactive molecules. The hydroxyl group enhances reactivity, allowing for further modifications, while the nitro group can participate in reduction reactions to form amines. Its structure makes it useful in creating novel compounds with potential applications in medicinal chemistry, agrochemicals, and dyes.
CAS Number | 3272-08-0 |
Molecular Formula | C7H4N2O3 |
Purity | ≥95% |
IUPAC Name | 4-hydroxy-3-nitrobenzonitrile |
InChI | InChI=1S/C7H4N2O3/c8-4-5-1-2-7(10)6(3-5)9(11)12/h1-3,10H |
InChIKey | INBLGVOPOSGVTA-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])O |