For research use only. Not for therapeutic Use.
(-)-4-Hydroxy-4-(3-pyridyl)butanoic acid(Cat No.:M083434) is a specialized organic compound featuring both a pyridine ring and a hydroxybutanoic acid group. This structure is interesting due to the combination of a basic nitrogen-containing pyridyl group and a hydroxy acid, making it both hydrophilic and capable of participating in hydrogen bonding. These properties suggest potential applications in biochemical and pharmaceutical research. Typically, compounds like this could be explored for their role as building blocks in synthesizing more complex molecules or as intermediates in drug development, particularly where specific receptor binding or solubility properties are required.
CAS Number | 15569-97-8 |
Molecular Formula | C9H11NO3 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 4-hydroxy-4-pyridin-3-ylbutanoic acid |
InChI | InChI=1S/C9H11NO3/c11-8(3-4-9(12)13)7-2-1-5-10-6-7/h1-2,5-6,8,11H,3-4H2,(H,12,13) |
InChIKey | STZOZPPVGWNSMC-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(CCC(=O)O)O |