For research use only. Not for therapeutic Use.
4-Hydroxy-4-phenylpiperidine(Cat No.:R063856), is a chemical compound with the molecular formula C12H15NO. It belongs to the piperidine family and features both a hydroxy group (-OH) and a phenyl group attached to a piperidine ring. This compound’s distinctive structure makes it of interest in various chemical applications, potentially serving as a building block in organic synthesis for creating diverse molecules. The presence of the hydroxy group and the phenyl group on the piperidine ring could contribute to specific reactivity and properties, making it valuable in pharmaceutical and chemical research.
CAS Number | 40807-61-2 |
Synonyms | 4-Phenyl-4-hydroxypiperidine; 4-Phenyl-4-piperidinol; NSC 71658; [1,4’-Bipiperidin]-4’-ol |
Molecular Formula | C11H15NO |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | 4-phenylpiperidin-4-ol |
InChI | InChI=1S/C11H15NO/c13-11(6-8-12-9-7-11)10-4-2-1-3-5-10/h1-5,12-13H,6-9H2 |
InChIKey | KQKFQBTWXOGINC-UHFFFAOYSA-N |
SMILES | C1CNCCC1(C2=CC=CC=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |