For research use only. Not for therapeutic Use.
4-Hydroxycoumarin（Cat No.:R040373）is a naturally occurring compound with a benzene ring fused to a lactone structure, featuring a hydroxyl group at the 4-position. It is widely used in pharmaceutical, cosmetic, and chemical research due to its potential anticoagulant properties, as it serves as a precursor in the synthesis of various anticoagulant drugs. 4-Hydroxycoumarin also exhibits antimicrobial, anti-inflammatory, and antioxidant activities, making it a subject of interest for drug discovery. Its derivatives are studied for applications in cancer treatment, skin care, and as flavoring agents in food and beverages.
| CAS Number | 1076-38-6 |
| Synonyms | 4-Hydroxy-2H-1-benzopyran-2-one; 4-Coumarinol; 4-Hydroxy-2H-1-benzopyran-2-one; 4-Hydroxy-2H-benzo[b]pyran-2-one; 4-Hydroxy-2H-chromen-2-one; 4-Hydroxychromen-2-one; 4-Hydroxycoumariin; 4-Hydroxycoumarin; Benzotetronic Acid; NSC 11889 |
| Molecular Formula | C9H6O3 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Store at -20°C |
| IUPAC Name | 4-hydroxychromen-2-one |
| InChI | InChI=1S/C9H6O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,10H |
| InChIKey | VXIXUWQIVKSKSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)O2)O |
