For research use only. Not for therapeutic Use.
4′-Hydroxy flurbiprofen(Cat No.:R004411) is a metabolite of flurbiprofen, a nonsteroidal anti-inflammatory drug (NSAID) used to treat pain, inflammation, and fever. The 4-hydroxy metabolite is formed in the body through the metabolism of flurbiprofen. While flurbiprofen primarily inhibits the enzyme cyclooxygenase (COX), leading to its anti-inflammatory effects, the specific role of the 4′-hydroxy metabolite in the drug’s pharmacology is not fully understood. However, it is believed to contribute to the overall pharmacological profile of flurbiprofen.
CAS Number | 52807-12-2 |
Synonyms | 2-Fluoro-4’-hydroxy-α-methyl-[1,1’-biphenyl]-4-acetic Acid; 2-(4’-Hydroxy-2-fluoro-4-biphenylyl)propionic Acid; 4’-Hydroxyflurbiprofen; FPH; |
Molecular Formula | C15H13FO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[3-fluoro-4-(4-hydroxyphenyl)phenyl]propanoic acid |
InChI | InChI=1S/C15H13FO3/c1-9(15(18)19)11-4-7-13(14(16)8-11)10-2-5-12(17)6-3-10/h2-9,17H,1H3,(H,18,19) |
InChIKey | GTSMMBJBNJDFRA-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=C(C=C1)C2=CC=C(C=C2)O)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |