For research use only. Not for therapeutic Use.
4-Hydroxy Nonenal Mercapturic Acid(Cat No.:M094961)is a significant biomarker for oxidative stress and lipid peroxidation. This compound, formed by the conjugation of 4-hydroxy nonenal (a lipid peroxidation product) with glutathione, is excreted as mercapturic acid in urine. Its detection and quantification are crucial in studying cellular damage and disease progression related to oxidative stress, such as cancer, neurodegenerative diseases, and cardiovascular disorders. 4-Hydroxy Nonenal Mercapturic Acid is valuable in clinical research and diagnostics, providing insights into the molecular mechanisms of oxidative damage and potential therapeutic targets.
Catalog Number | M094961 |
CAS Number | 146764-24-1 |
Synonyms | N-acetyl-S-(tetrahydro-5-hydroxy-2-pentyl-3-furanyl)-L-cysteine |
Molecular Formula | C14H25NO5S |
Purity | 98% |
Storage | -80°C |
IUPAC Name | (2R)-2-acetamido-3-(5-hydroxy-2-pentyloxolan-3-yl)sulfanylpropanoic acid |
InChI | InChI=1S/C14H25NO5S/c1-3-4-5-6-11-12(7-13(17)20-11)21-8-10(14(18)19)15-9(2)16/h10-13,17H,3-8H2,1-2H3,(H,15,16)(H,18,19)/t10-,11?,12?,13?/m0/s1 |
InChIKey | DEWNQQSQBYUUAE-DCNVRKPOSA-N |
SMILES | CCCCCC1C(CC(O1)O)SCC(C(=O)O)NC(=O)C |