For research use only. Not for therapeutic Use.
4’-Hydroxy-PhIP (CAT: R011644) is a metabolite and derivative of 2-amino-1-methyl-6-phenylimidazo[4,5-b]pyridine (PhIP), a heterocyclic aromatic amine found in cooked meat and a known environmental carcinogen. The formation of this hydroxylated derivative occurs through enzymatic metabolism, primarily involving cytochrome P450 enzymes. In terms of pharmacological action, 4’-Hydroxy-PhIP is recognized for its potential role in contributing to the genotoxicity and carcinogenicity associated with PhIP exposure.
Catalog Number | R011644 |
CAS Number | 126861-72-1 |
Synonyms | 4-(2-Amino-1-methyl-1H-imidazo[4,5-b]pyridin-6-yl)phenol; 2-Amino-4’-hydroxy-1-methyl-6-phenylimidazo[4,5-b]pyridine; |
Molecular Formula | C13H12N4O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4-(2-amino-1-methylimidazo[4,5-b]pyridin-6-yl)phenol |
InChI | InChI=1S/C13H12N4O/c1-17-11-6-9(7-15-12(11)16-13(17)14)8-2-4-10(18)5-3-8/h2-7,18H,1H3,(H2,14,15,16) |
InChIKey | UGJXOCBVCWTJFP-UHFFFAOYSA-N |
SMILES | CN1C2=C(N=CC(=C2)C3=CC=C(C=C3)O)N=C1N |