For research use only. Not for therapeutic Use.
4-Hydroxy trimethoprim is a derivative of trimethoprim, an antibiotic used to treat bacterial infections. This compound is formed through hydroxylation of trimethoprim, leading to altered pharmacological properties. 4-Hydroxy trimethoprim may exhibit enhanced antibacterial activity or altered spectrum of action compared to trimethoprim alone. It is studied for its potential as a novel antibiotic agent with improved efficacy against specific bacterial strains. Research focuses on optimizing its pharmacokinetic profile and therapeutic benefits in combating infectious diseases.
| Catalog Number | R053557 |
| CAS Number | 112678-48-5 |
| Synonyms | 2,6-Diamino-5-[(3,4,5-trimethoxyphenyl)methyl]-4(5H)-pyrimidinone |
| Molecular Formula | C14H18N4O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,6-diamino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidin-4-one |
| InChI | InChI=1S/C14H18N4O4/c1-20-9-5-7(6-10(21-2)11(9)22-3)4-8-12(15)17-14(16)18-13(8)19/h5-6H,4H2,1-3H3,(H5,15,16,17,18,19) |
| InChIKey | FYJKTYLNKCUCLP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CC2=C(NC(=NC2=O)N)N |
