For research use only. Not for therapeutic Use.
4-Hydroxyatomoxetine-d3(Cat No.:S000478) is a deuterated form of 4-hydroxyatomoxetine, where three hydrogen atoms are replaced with deuterium. This modification enhances the study of the compound’s pharmacokinetics and stability in the body. 4-Hydroxyatomoxetine is a major active metabolite of atomoxetine, a medication primarily used to treat attention deficit hyperactivity disorder (ADHD). It works by inhibiting the reuptake of norepinephrine, thereby increasing its availability in the brain. The deuterated version, 4-Hydroxyatomoxetine-d3, helps researchers investigate how deuteration impacts the metabolism and effectiveness of the drug, providing valuable insights into its therapeutic properties.
Catalog Number | S000478 |
CAS Number | 1217686-14-0 |
Molecular Formula | C17H18D3NO2 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 3-methyl-4-[(1R)-1-phenyl-3-(trideuteriomethylamino)propoxy]phenol |
InChI | InChI=1S/C17H21NO2/c1-13-12-15(19)8-9-16(13)20-17(10-11-18-2)14-6-4-3-5-7-14/h3-9,12,17-19H,10-11H2,1-2H3/t17-/m1/s1/i2D3 |
InChIKey | PPXQPRLGNSJNJM-NVNSKBCASA-N |
SMILES | CC1=C(C=CC(=C1)O)OC(CCNC)C2=CC=CC=C2 |