For research use only. Not for therapeutic Use.
4-Hydroxybenzaldehyde (Cat.No:R040793) is an organic compound with a phenolic and an aldehyde functional group. It is commonly used in the synthesis of various pharmaceuticals, agrochemicals, and perfumes. Additionally, it serves as a precursor in the production of flavors and fragrances, making it a versatile compound in the chemical industry.
CAS Number | 123-08-0 |
Synonyms | p-hydroxybenzaldehyde; 4-Formylphenol; NSC 2127; Parahydroxybenzaldehyde; p-Formylphenol; p-Hydroxybenzaldehyde; p-Oxybenzaldehyde |
Molecular Formula | C7H6O2 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | 4-hydroxybenzaldehyde |
InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
InChIKey | RGHHSNMVTDWUBI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)O |