For research use only. Not for therapeutic Use.
4′-Hydroxyflavanone（Cat No.:I043801）is a flavonoid compound characterized by a hydroxyl group (-OH) at the 4′ position of the flavanone structure. It is found in various plant species and has been studied for its potential antioxidant, anti-inflammatory, and anticancer properties. 4′-Hydroxyflavanone exerts its biological effects by scavenging free radicals, inhibiting enzymes involved in inflammation, and modulating cellular signaling pathways. It has shown promise in preclinical research as a potential therapeutic agent for conditions like cardiovascular diseases, cancer, and neurodegenerative disorders. Its bioactivity makes it a valuable compound in natural product chemistry and drug development.
| CAS Number | 6515-37-3 |
| Synonyms | 2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O3/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,15-16H,9H2 |
| InChIKey | ZLHVIYHWWQYJID-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2C1=O)C3=CC=C(C=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
