For research use only. Not for therapeutic Use.
4-Hydroxymetanilic acid(Cat No.:I014008) is a biochemical compound that belongs to the class of aromatic acids. It is derived from metanilic acid, which is an aromatic amine. 4-Hydroxymetanilic acid has a hydroxyl group (-OH) attached to the aromatic ring. This compound may have various applications in biochemical research and can serve as a building block or precursor in the synthesis of other molecules. Further specific information about its properties and applications would depend on the context and intended use in research or industry.
CAS Number | 98-37-3 |
Synonyms | 4-Hydroxymetanilic acid; NSC 1491; NSC1491; NSC-1491;2-Amino-1-phenol-4-sulfonic acid |
Molecular Formula | C6H7NO4S |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | Room Temperature |
IUPAC Name | 3-amino-4-hydroxybenzenesulfonic acid |
InChI | InChI=1S/C6H7NO4S/c7-5-3-4(12(9,10)11)1-2-6(5)8/h1-3,8H,7H2,(H,9,10,11) |
InChIKey | ULUIMLJNTCECJU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)O)N)O |