4-(Hydroxymethyl)piperidin-4-ol (Cat.No:L035322) is a chemical compound with applications in organic synthesis and medicinal chemistry. Its piperidine ring structure combined with a hydroxymethyl group makes it a versatile building block for creating diverse molecules. This compound is valuable for producing pharmaceuticals and other compounds for various industries.
| Catalog Number | L035322 |
| CAS Number | 89584-31-6 |
| Molecular Formula | C6H13NO2 |
| Purity | ≥95% |
| IUPAC Name | 4-(hydroxymethyl)piperidin-4-ol |
| InChI | InChI=1S/C6H13NO2/c8-5-6(9)1-3-7-4-2-6/h7-9H,1-5H2 |
| InChIKey | BCOGPFMRSSZIFM-UHFFFAOYSA-N |
