For research use only. Not for therapeutic Use.
[4-(Hydroxymethyl)pyridin-3-yl]methanol hydrochloride(Cat No.:L022923)is a pyridine derivative used as an intermediate in pharmaceutical synthesis and chemical research. The compound features two hydroxymethyl groups attached to the pyridine ring at the 3- and 4-positions, with its hydrochloride form enhancing solubility and stability. This structure allows for versatile chemical modifications, making it valuable in the development of bioactive molecules and complex organic compounds. It is particularly useful in medicinal chemistry for synthesizing potential drug candidates and other biologically active substances, contributing to various research and development efforts.
CAS Number | 53654-42-5 |
Molecular Formula | C7H10ClNO2 |
Purity | ≥95% |
IUPAC Name | [3-(hydroxymethyl)pyridin-4-yl]methanol;hydrochloride |
InChI | InChI=1S/C7H9NO2.ClH/c9-4-6-1-2-8-3-7(6)5-10;/h1-3,9-10H,4-5H2;1H |
InChIKey | KRZRQRQGRZBMDP-UHFFFAOYSA-N |
SMILES | C1=CN=CC(=C1CO)CO.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |