For research use only. Not for therapeutic Use.
4-Hydroxynicotinaldehyde is a pyridine derivative characterized by a hydroxyl group at the 4-position and an aldehyde group. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate in the development of various bioactive molecules. The hydroxyl group enhances its reactivity and solubility, while the aldehyde functionality allows for further derivatization. Its unique structure makes it valuable in the synthesis of pharmaceuticals and agrochemicals, as well as in exploring new therapeutic applications and chemical research.
CAS Number | 89380-70-1 |
Molecular Formula | C6H5NO2 |
Purity | ≥95% |
IUPAC Name | 4-oxo-1H-pyridine-3-carbaldehyde |
InChI | InChI=1S/C6H5NO2/c8-4-5-3-7-2-1-6(5)9/h1-4H,(H,7,9) |
InChIKey | IYPSYYLXHFGFPC-UHFFFAOYSA-N |
SMILES | C1=CNC=C(C1=O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |