For research use only. Not for therapeutic Use.
4-Hydroxynonenal-d3（Cat No.:S000433） is a deuterated form of 4-Hydroxynonenal (4-HNE), where three hydrogen atoms are replaced with deuterium. This modification is used to enhance the compound’s stability for detailed analytical and biological studies. 4-HNE is a bioactive aldehyde, generated during lipid peroxidation, known for its role in signaling cell damage and contributing to various pathological processes, including inflammation and apoptosis. The deuterated version, 4-Hydroxynonenal-d3, is particularly valuable in studying the dynamics of oxidative stress and its impact on cellular mechanisms, aiding in understanding the progression of diseases linked to oxidative damage.
| CAS Number | 148706-06-3 |
| Molecular Formula | C9H13D3O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-9,9,9-trideuterio-4-hydroxynon-2-enal |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5+/i1D3 |
| InChIKey | JVJFIQYAHPMBBX-PKJLGKQPSA-N |
| SMILES | CCCCCC(C=CC=O)O |
