For research use only. Not for therapeutic Use.
4-<wbr></wbr>hydroxy Nonenal is a lipid peroxidation product derived from oxidized ω-<wbr></wbr>6 polyunsaturated fatty acids such as arachidonic acid. 4-<wbr></wbr>hydroxy Nonenal is widely used as a marker of lipid peroxidation. It exhibits various biological activities such as cytotoxicity, growth inhibiting activity, genotoxicity, and chemotactic activity. 4-<wbr></wbr>hydroxy Nonenal inhibits pro-<wbr></wbr>oxidant-<wbr></wbr>induced Ca<sup>2+</sup> release from mitochondria at 10-<wbr></wbr>50 µM.
| Catalog Number | R067221 |
| CAS Number | 75899-68-2 |
| Synonyms | 4-HNE |
| Molecular Formula | C9H16O2 |
| Purity | ≥95% |
| Target | Aldehyde Dehydrogenase (ALDH) |
| Storage | -80°C |
| IUPAC Name | (E)-4-hydroxynon-2-enal |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5+ |
| InChIKey | JVJFIQYAHPMBBX-FNORWQNLSA-N |
| SMILES | CCCCCC(C=CC=O)O |
| Reference | 1.Pryor, W.A. and Porter, N.A. Suggested mechanisms for the production of 4-hydroxy-2-nonenal from the autoxidation of polyunsaturated fatty acids. Free Radical Biology & Medicine 8, 541-543 (1990). |
