For research use only. Not for therapeutic Use.
4-Hydroxyphenylglyoxylic acid(Cat No.:M086278) is an organic compound belonging to the aromatic acids category, featuring both phenolic and carboxylic functional groups. This compound includes a benzene ring substituted with a hydroxyl group at the 4-position and a glyoxylic acid moiety attached at the benzene ring’s 1-position. It acts as a key intermediate in various biochemical pathways and industrial processes. In pharmaceutical research, it is explored for its potential in synthesizing drug metabolites and other complex organic molecules. Its properties are also studied for potential applications in developing new therapeutic agents, particularly those targeting specific enzymatic pathways.
CAS Number | 15573-67-8 |
Synonyms | 4-Hydroxyphenylglyoxylic acid |
Molecular Formula | C8H6O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(4-hydroxyphenyl)-2-oxoacetic acid |
InChI | InChI=1S/C8H6O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,9H,(H,11,12) |
InChIKey | KXFJZKUFXHWWAJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |