For research use only. Not for therapeutic Use.
4-Hydroxyphenylpyruvic Acid(Cat No.:R031902)is a key intermediate in the metabolic pathway of tyrosine, an essential amino acid. This compound is involved in the biosynthesis of important biological molecules such as dopamine, melanin, and thyroid hormones. In biochemical research, 4-Hydroxyphenylpyruvic Acid is used to study metabolic disorders, including tyrosinemia and alkaptonuria. Its role in various enzymatic reactions makes it valuable for exploring enzyme kinetics and metabolic regulation. Additionally, it serves as a precursor in synthetic organic chemistry for developing pharmaceuticals and agrochemicals, highlighting its broad utility in science and industry.
Catalog Number | R031902 |
CAS Number | 156-39-8 |
Synonyms | (p-Hydroxyphenyl)pyruvic Acid; 3-(4-Hydroxyphenyl)-2-oxopropanoic Acid;?3-(4-Hydroxyphenyl)-2-oxopropionic Acid; 3-(4-Hydroxyphenyl)pyruvic Acid;?3-(p-Hydroxyphenyl)-2-oxopropionic Acid; 3-(p-Hydroxyphenyl)pyruvic Acid;?4-Hydroxy-α-oxobenzenepropanoi |
Molecular Formula | C9H8O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Store at RT |
IUPAC Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid |
InChI | InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13) |
InChIKey | KKADPXVIOXHVKN-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)O |