For research use only. Not for therapeutic Use.
4-Iodo-1-(4-methoxybenzyl)-1H-pyrazole is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure includes a pyrazole ring with an iodine atom at position 4 and a 4-methoxybenzyl group attached to the nitrogen atom, making it a versatile intermediate for developing bioactive molecules. This compound is often employed in drug discovery and the synthesis of complex organic compounds due to its reactivity and potential for further chemical modifications, contributing to advancements in medicinal chemistry.
CAS Number | 905751-58-8 |
Molecular Formula | C11H11IN2O |
Purity | ≥95% |
IUPAC Name | 4-iodo-1-[(4-methoxyphenyl)methyl]pyrazole |
InChI | InChI=1S/C11H11IN2O/c1-15-11-4-2-9(3-5-11)7-14-8-10(12)6-13-14/h2-6,8H,7H2,1H3 |
InChIKey | ZXNZREKRXQRZNP-UHFFFAOYSA-N |