For research use only. Not for therapeutic Use.
4-Iodo-1-isopropyl-1H-pyrazole(Cat No.:L037075)is a heterocyclic compound featuring an iodine atom at the 4-position and an isopropyl group at the 1-position on a pyrazole ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic molecules. Its structure allows for targeted functionalization, making it valuable in medicinal chemistry and the development of novel bioactive compounds. With its high reactivity and purity, 4-Iodo-1-isopropyl-1H-pyrazole is essential for advanced research and chemical synthesis applications.
Catalog Number | L037075 |
CAS Number | 313350-82-2 |
Molecular Formula | C6H9IN2 |
Purity | ≥95% |
IUPAC Name | 4-iodo-1-propan-2-ylpyrazole |
InChI | InChI=1S/C6H9IN2/c1-5(2)9-4-6(7)3-8-9/h3-5H,1-2H3 |
InChIKey | CFXNVDUEBJYAAZ-UHFFFAOYSA-N |
SMILES | CC(C)N1C=C(C=N1)I |