4-iodo-1-Methyl-1H-pyrazole-5-carbaldehyde

For research use only. Not for therapeutic Use.

  • CAT Number: L035974
  • CAS Number: 959986-66-4
  • Molecular Formula: C5H5IN2O
  • Molecular Weight: 236.01
  • Purity: ≥95%
Inquiry Now

4-Iodo-1-Methyl-1H-pyrazole-5-carbaldehyde(Cat No.:L035974)is a specialized organic compound frequently used in pharmaceutical and chemical research. Featuring an iodine atom and a formyl group attached to a methylated pyrazole ring, this compound serves as a crucial intermediate in the synthesis of complex molecules. Its unique structure enables versatile chemical modifications, making it valuable in the development of novel therapeutic agents and bioactive compounds. 4-Iodo-1-Methyl-1H-pyrazole-5-carbaldehyde plays a significant role in high-precision synthesis, supporting advancements in medicinal chemistry and innovative research.


Catalog Number L035974
CAS Number 959986-66-4
Molecular Formula C5H5IN2O
Purity ≥95%
IUPAC Name 4-iodo-2-methylpyrazole-3-carbaldehyde
InChI InChI=1S/C5H5IN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3
InChIKey QYQOXBFGROQSBB-UHFFFAOYSA-N
SMILES CN1C(=C(C=N1)I)C=O

Request a Quote