For research use only. Not for therapeutic Use.
4-Iodo-1-Methyl-1H-pyrazole-5-carbaldehyde(Cat No.:L035974)is a specialized organic compound frequently used in pharmaceutical and chemical research. Featuring an iodine atom and a formyl group attached to a methylated pyrazole ring, this compound serves as a crucial intermediate in the synthesis of complex molecules. Its unique structure enables versatile chemical modifications, making it valuable in the development of novel therapeutic agents and bioactive compounds. 4-Iodo-1-Methyl-1H-pyrazole-5-carbaldehyde plays a significant role in high-precision synthesis, supporting advancements in medicinal chemistry and innovative research.
CAS Number | 959986-66-4 |
Molecular Formula | C5H5IN2O |
Purity | ≥95% |
IUPAC Name | 4-iodo-2-methylpyrazole-3-carbaldehyde |
InChI | InChI=1S/C5H5IN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3 |
InChIKey | QYQOXBFGROQSBB-UHFFFAOYSA-N |
SMILES | CN1C(=C(C=N1)I)C=O |