For research use only. Not for therapeutic Use.
4-Iodo-1-(phenylmethoxy)-1H-pyrazole is a high-purity compound essential for advanced pharmaceutical and chemical research. This iodinated pyrazole derivative is crucial for studies involving organic synthesis, medicinal chemistry, and molecular interactions. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| Catalog Number | R019610 |
| CAS Number | 229171-07-7 |
| Molecular Formula | C10H9IN2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-iodo-1-phenylmethoxypyrazole |
| InChI | InChI=1S/C10H9IN2O/c11-10-6-12-13(7-10)14-8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | VLRXSAMTKJXSPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C=C(C=N2)I |
