For research use only. Not for therapeutic Use.
4-Iodo-2-methoxyphenol(Cat No.:L006694), is a chemical compound comprising a phenol ring substituted with an iodine atom and a methoxy group. This compound is essential in organic synthesis, serving as a key intermediate in the preparation of various complex molecules. Its unique structure and reactivity make it valuable in medicinal chemistry, where it may be utilized in drug discovery research. The presence of both iodine and methoxy groups enhances its versatility, enabling its use in diverse chemical transformations. Researchers leverage its distinct properties, contributing significantly to advancements in drug development and scientific research.
CAS Number | 203861-62-5 |
Molecular Formula | C7H7IO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-iodo-2-methoxyphenol |
InChI | InChI=1S/C7H7IO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
InChIKey | KJXYWMSTOWBZHC-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)I)O |