For research use only. Not for therapeutic Use.
4-Iodo-2-methyl-1-(trifluoromethyl)benzene (Cat.No:L004176) is a pivotal compound in organic synthesis. Its unique structure, combining iodo, methyl, and trifluoromethyl groups, imparts distinctive reactivity. This compound serves as a valuable building block in the creation of specialized molecules with potential applications in pharmaceutical and chemical research.
Catalog Number | L004176 |
CAS Number | 930599-57-8 |
Molecular Formula | C8H6F3I |
Purity | ≥95% |
IUPAC Name | 4-iodo-2-methyl-1-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H6F3I/c1-5-4-6(12)2-3-7(5)8(9,10)11/h2-4H,1H3 |
InChIKey | VVIDIHOUJXGOHT-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)I)C(F)(F)F |