For research use only. Not for therapeutic Use.
4-Iodo-2-methyl aniline(Cat No.:M055652), is a chemical compound with the molecular formula C7H8IN. It is characterized by a methyl group (-CH3) and an iodine atom attached to an aniline ring. This compound’s specific arrangement of atoms makes it potentially useful in various chemical applications, particularly in organic synthesis. The presence of both the methyl group and the iodine atom on the aniline ring can influence its reactivity, making it valuable as an intermediate for creating complex molecules, such as pharmaceuticals, agrochemicals, and specialty chemicals, through selective functionalization reactions.
CAS Number | 13194-68-8 |
Molecular Formula | C7H8IN |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-iodo-2-methylaniline |
InChI | InChI=1S/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
InChIKey | BGKLFAQCHHCZRZ-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)I)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |