For research use only. Not for therapeutic Use.
4-Iodo-3-(trifluoromethyl)benzoic acid(Cat No.:L033030)is an aromatic compound featuring an iodine atom at the 4-position and a trifluoromethyl group at the 3-position on a benzoic acid core. This compound is widely used in pharmaceutical research and organic synthesis, particularly as a building block for the development of complex molecules, including drug candidates and specialty chemicals. Its iodine and trifluoromethyl groups provide unique reactivity, making it ideal for cross-coupling reactions and other chemical transformations. Researchers in medicinal chemistry utilize this compound for designing innovative therapeutic agents and advanced materials.
CAS Number | 914636-20-7 |
Molecular Formula | C8H4F3IO2 |
Purity | ≥95% |
IUPAC Name | 4-iodo-3-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H4F3IO2/c9-8(10,11)5-3-4(7(13)14)1-2-6(5)12/h1-3H,(H,13,14) |
InChIKey | TZAMLJCNESLFDI-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)I |