Home
>
Reference Standards>Heterocyclic Building Blocks> 4-IODO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER
For research use only. Not for therapeutic Use.
4-Iodo-benzo[b]thiophene-2-carboxylic acid methyl ester(Cat No.:M105054)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. Featuring an iodine atom and a benzo[b]thiophene core with a methyl ester functional group, this compound is essential for the synthesis of bioactive molecules, particularly in drug discovery and development. Its unique structure allows for selective reactivity and diverse chemical transformations, making it a valuable building block in medicinal chemistry. Ideal for precision research, this compound supports innovative approaches in creating new therapeutic agents.
CAS Number | 146137-85-1 |
Molecular Formula | C10H7IO2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 4-iodo-1-benzothiophene-2-carboxylate |
InChI | InChI=1S/C10H7IO2S/c1-13-10(12)9-5-6-7(11)3-2-4-8(6)14-9/h2-5H,1H3 |
InChIKey | UGNPKTSBZTYSKG-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=C(S1)C=CC=C2I |