For research use only. Not for therapeutic Use.
4-Ipomeanol-d6 is a deuterated form of 4-ipomeanol, a compound known for its use in studying oxidative metabolism and its potential effects as a pulmonary toxicant. The six deuterium atoms replace hydrogen atoms in the molecule, providing a stable isotopic label that enhances its utility in metabolic and pharmacokinetic studies. This labeled compound is valuable for tracing metabolic pathways, understanding the biochemical interactions of ipomeanol, and investigating its effects on biological systems. Its applications are crucial in environmental health research, toxicology, and analytical chemistry for studying chemical behavior and safety.
CAS Number | 848750-68-5 |
Synonyms | 1-(3-Furanyl)-4-hydroxy-1-pentanone; 1-(3-Furyl)-4-hydroxy-1-pentanone-d6; Ipomeanol-d6 |
Molecular Formula | C₉H₆D₆O₃ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,3,4,5,5,5-hexadeuterio-1-(furan-3-yl)-4-hydroxypentan-1-one |
InChI | InChI=1S/C9H12O3/c1-7(10)2-3-9(11)8-4-5-12-6-8/h4-7,10H,2-3H2,1H3/i1D3,2D2,7D |
InChIKey | RJYQLMILDVERHH-DTHBTZQSSA-N |
SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])CC(=O)C1=COC=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |