For research use only. Not for therapeutic Use.
4-Isobutylbenzoic acid(Cat No.:I014953), is a chemical compound used primarily in the synthesis of pharmaceuticals and organic compounds. It is a derivative of benzoic acid, with an isobutyl group attached to its structure. This compound is valued for its role as a building block in the production of various drugs and intermediates, particularly in the pharmaceutical industry. Its chemical properties make it suitable for constructing complex molecules, facilitating the creation of innovative medications and research chemicals. 4-Isobutylbenzoic acid’s versatility in organic synthesis contributes to advancements in drug discovery and development.
Catalog Number | I014953 |
CAS Number | 38861-88-0 |
Molecular Formula | C₁₁H₁₄O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(2-methylpropyl)benzoic acid |
InChI | InChI=1S/C11H14O2/c1-8(2)7-9-3-5-10(6-4-9)11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13) |
InChIKey | VUBBCFWWSKOHTH-UHFFFAOYSA-N |
SMILES | CC(C)CC1=CC=C(C=C1)C(=O)O |
Reference | [1]. V. Beghetto, et al. Synthesis of 4-Isobutylbenzaldehyde an Important |